For research use only. Not for therapeutic Use.
Ranolazine 2HCl is a medication used to treat chronic angina (chest pain) by improving blood flow to the heart. It works by inhibiting the late sodium current in heart muscle cells, which reduces calcium overload and helps the heart relax, improving its efficiency. Ranolazine does not significantly affect heart rate or blood pressure. It is typically used as an adjunct to other anti-anginal treatments. Common side effects include dizziness, nausea, and constipation, and it requires monitoring for potential interactions with other medications.
| Catalog Number | A000738 |
| CAS Number | 95635-56-6 |
| Synonyms | RS-43285 |
| Molecular Formula | C24H33N3O4 • 2HCl |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | >20.3mg/mL in DMSO |
| Storage | store at -20℃ |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-(2-methoxyphenoxy)propyl]piperazin-1-yl]acetamide;dihydrochloride |
| InChI | 1S/C24H33N3O4.2ClH/c1-18-7-6-8-19(2)24(18)25-23(29)16-27-13-11-26(12-14-27)15-20(28)17-31-22-10-5-4-9-21(22)30-3;;/h4-10,20,28H,11-17H2,1-3H3,(H,25,29);2*1H |
| InChIKey | RJNSNFZXAZXOFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCN(CC2)CC(COC3=CC=CC=C3OC)O.Cl.Cl |
