For research use only. Not for therapeutic Use.
Raphin1(Cat No.:I018136)is a small-molecule inhibitor that targets the Raph family of proteins, specifically RAPH1 and RAPH2, which play a critical role in regulating cell signaling, particularly in cancer and other diseases. By inhibiting these proteins, Raphin1 disrupts cellular processes like cell proliferation, survival, and migration, making it a promising candidate for cancer therapy. Preclinical studies have shown that Raphin1 can reduce tumor growth and enhance sensitivity to other chemotherapeutic agents. Its selective action on Raph proteins positions it as a potential therapeutic option in oncology, particularly for cancers with dysregulated Raph signaling.
CAS Number | 2022961-17-5 |
Molecular Formula | C₈H₈Cl₂N₄ |
Purity | ≥95% |
Target | Phosphatase |
IUPAC Name | 2-[(E)-(2,3-dichlorophenyl)methylideneamino]guanidine |
InChI | InChI=1S/C8H8Cl2N4/c9-6-3-1-2-5(7(6)10)4-13-14-8(11)12/h1-4H,(H4,11,12,14)/b13-4+ |
InChIKey | WLTSTDGGFCQWTK-YIXHJXPBSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C=N/N=C(N)N |