For research use only. Not for therapeutic Use.
Rapidosept-d2(Cat No.:R046525) is a deuterated variant of Rapidosept, where two hydrogen atoms are replaced with deuterium. This isotopic labeling enhances the compound’s stability, making it particularly useful for detailed pharmacokinetic and chemical stability studies. Rapidosept is typically used as a disinfectant or antiseptic agent, implying its role in eliminating or controlling the growth of harmful microorganisms. The deuterated version, Rapidosept-d2, allows for more precise tracking and analysis of the compound’s behavior and degradation under various conditions, aiding in the development and optimization of more effective and safer disinfection and sterilization practices.
CAS Number | 883001-15-8 |
Synonyms | 2,4-Dichloro-benzenemethanol-d2; 2,4-Dichloro-benzyl Alcohol-d2; 2,4-Dichlorobenzenemethanol-d2; 2,4-Dichlorobenzyl Alcohol-d2; Dybenal-d2; Myacide-d2; Myacide SP-d2; NSC 15635-d2; |
Molecular Formula | C7H6Cl2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dideuterio-(2,4-dichlorophenyl)methanol |
InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2/i4D2 |
InChIKey | DBHODFSFBXJZNY-APZFVMQVSA-N |
SMILES | [2H]C([2H])(C1=C(C=C(C=C1)Cl)Cl)O |