For research use only. Not for therapeutic Use.
Rapidosept（Cat No.:R046526）, also known as 2,4-dichlorobenzyl alcohol, is an organic compound with antimicrobial properties, commonly used as a preservative in pharmaceuticals and personal care products to prevent bacterial and fungal contamination. Its effectiveness at low concentrations makes it suitable for various formulations, including lozenges and throat sprays, where it helps alleviate minor throat irritations by reducing microbial presence. Additionally, Rapidosept serves as a chemical intermediate in organic synthesis, contributing to the production of more complex compounds in the pharmaceutical and chemical industries.
| Catalog Number | R046526 |
| CAS Number | 1777-82-8 |
| Synonyms | 2,4-Dichloro-benzenemethanol; 2,4-Dichloro-benzyl Alcohol; 2,4-Dichlorobenzenemethanol; 2,4-Dichlorobenzyl Alcohol; Dybenal; Myacide; Myacide SP; NSC 15635; |
| Molecular Formula | C7H6Cl2O |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | (2,4-dichlorophenyl)methanol |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| InChIKey | DBHODFSFBXJZNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CO |
