Rasagiline-13C3(Cat No.:S000523) mesylate is an isotopically labeled form of rasagiline mesylate, where three carbon atoms are replaced with carbon-13 (13C). Rasagiline is a medication used primarily to treat symptoms of Parkinson’s disease by inhibiting monoamine oxidase type B, an enzyme that breaks down dopamine in the brain. The 13C labeling in rasagiline-13C3 mesylate enables precise tracking of the drug’s metabolic pathways and distribution within the body using advanced analytical methods like mass spectrometry.
Catalog Number | S000523 |
CAS Number | 1391052-18-8 |
Molecular Formula | C1013C3H17NO3S |
Purity | 95% |
IUPAC Name | methanesulfonic acid;(1R)-N-(1,2,3-13C3)prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
InChI | InChI=1S/C12H13N.CH4O3S/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;1-5(2,3)4/h1,3-6,12-13H,7-9H2;1H3,(H,2,3,4)/t12-;/m1./s1/i1+1,2+1,9+1; |
InChIKey | JDBJJCWRXSVHOQ-UAWGACSXSA-N |
SMILES | CS(=O)(=O)O.C#CCNC1CCC2=CC=CC=C12 |