For research use only. Not for therapeutic Use.
RDR 02308（Cat No.:I041271）is an investigational compound being studied for its potential applications in treating various diseases, including cancer and autoimmune disorders. It is designed to target specific molecular pathways involved in disease progression, such as cell growth, inflammation, and immune system modulation. By inhibiting these pathways, RDR 02308 may help reduce tumor growth and modulate immune responses. Preclinical studies have shown promise, and ongoing research aims to assess its safety, efficacy, and potential as a targeted therapy. Its selective mechanism makes it a candidate for developing more precise and effective treatments.
| CAS Number | 4155-82-2 |
| Synonyms | 3-(furan-2-yl)-5-(4-nitrophenyl)-2-phenyl-3,4-dihydropyrazole |
| Molecular Formula | C19H15N3O3 |
| Purity | ≥95% |
| IUPAC Name | 3-(furan-2-yl)-5-(4-nitrophenyl)-2-phenyl-3,4-dihydropyrazole |
| InChI | InChI=1S/C19H15N3O3/c23-22(24)16-10-8-14(9-11-16)17-13-18(19-7-4-12-25-19)21(20-17)15-5-2-1-3-6-15/h1-12,18H,13H2 |
| InChIKey | DCFSIJLWXJXSQC-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=CC=C3)C4=CC=CO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
