For research use only. Not for therapeutic Use.
RDR 03785（Cat No.:I041250）is an experimental compound under investigation for its potential use in cancer therapy. It acts as an inhibitor of specific molecular targets involved in cancer cell growth and proliferation. The compound has shown promise in preclinical studies for its ability to disrupt tumor cell signaling pathways and induce cell cycle arrest, leading to reduced tumor growth. RDR 03785 is being explored for its efficacy against various cancer types, and its selective mechanism of action makes it a potential candidate for targeted cancer treatments with fewer side effects compared to traditional therapies.
| CAS Number | 289657-30-3 |
| Synonyms | 6-[morpholin-4-yl-[4-(trifluoromethyl)phenyl]methyl]-1,3-benzodioxol-5-ol |
| Molecular Formula | C19H18F3NO4 |
| Purity | ≥95% |
| IUPAC Name | 6-[morpholin-4-yl-[4-(trifluoromethyl)phenyl]methyl]-1,3-benzodioxol-5-ol |
| InChI | InChI=1S/C19H18F3NO4/c20-19(21,22)13-3-1-12(2-4-13)18(23-5-7-25-8-6-23)14-9-16-17(10-15(14)24)27-11-26-16/h1-4,9-10,18,24H,5-8,11H2 |
| InChIKey | AWQPMEGCCWPTRI-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(C2=CC=C(C=C2)C(F)(F)F)C3=CC4=C(C=C3O)OCO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
