For research use only. Not for therapeutic Use.
ReAsH-EDT<sub>2</sub> (Cat.No:R041856) is a fluorescent, membrane-permeable biarsenical compound that binds covalently to tetracysteine sequences, which are engineered into target proteins. It binds proteins that have the tetracysteine tag almost immediately after translation. ReAsH-EDT<sub>2</sub> is commonly used to study protein trafficking, folding, and interactions in living cells or cell lysates. This red-emitting fluorophore is excited at 593 nm, with emission at 608 nm.
| Catalog Number | R041856 |
| CAS Number | 438226-89-2 |
| Synonyms | 4,6-Bis(1,3,2-dithiarsolan-2-yl)-7-hydroxy-3H-phenoxazin-3-one; Lumio Red; ReAsH; |
| Molecular Formula | C16H13As2NO3S4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4,6-bis(1,3,2-dithiarsolan-2-yl)-7-hydroxyphenoxazin-3-one |
| InChI | InChI=1S/C16H13As2NO3S4/c20-11-3-1-9-15(13(11)17-23-5-6-24-17)22-16-10(19-9)2-4-12(21)14(16)18-25-7-8-26-18/h1-4,20H,5-8H2 |
| InChIKey | UNIBJWQHKWCMGJ-UHFFFAOYSA-N |
| SMILES | C1CS[As](S1)C2=C(C=CC3=C2OC4=C(C(=O)C=CC4=N3)[As]5SCCS5)O |
