For research use only. Not for therapeutic Use.
Rebimastat, also known as BMS275291, is a sulfhydryl-based second-generation matrix metalloproteinase (MMP) inhibitor with potential antineoplastic activity. Rebimastat selectively inhibits several MMPs (MMP 1, 2, 8, 9, and 14), thereby inducing extracellular matrix degradation, and inhibiting angiogenesis, tumor growth and invasion, and metastasis.
| Catalog Number | I008993 |
| CAS Number | 259188-38-0 |
| Synonyms | Rebimastat; BMS275291; BMS 275291; BMS-275291.;(S)-N-((S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl)-2-((S)-2-mercapto-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanamido)-N,4-dimethylpentanamide |
| Molecular Formula | C23H41N5O5S |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | (2S)-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-4-methyl-2-[[(2S)-2-sulfanyl-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)butanoyl]amino]pentanamide |
| InChI | InChI=1S/C23H41N5O5S/c1-13(2)12-14(17(29)26-16(19(31)24-8)22(3,4)5)25-18(30)15(34)10-11-28-20(32)23(6,7)27(9)21(28)33/h13-16,34H,10-12H2,1-9H3,(H,24,31)(H,25,30)(H,26,29)/t14-,15-,16+/m0/s1 |
| InChIKey | GTXSRFUZSLTDFX-HRCADAONSA-N |
| SMILES | CC(C)CC(C(=O)NC(C(=O)NC)C(C)(C)C)NC(=O)C(CCN1C(=O)C(N(C1=O)C)(C)C)S |
