For research use only. Not for therapeutic Use.
Regaloside A(Cat No.:M019278)is a phenylethanoid glycoside isolated from Plantago species and other medicinal herbs. It consists of a hydroxytyrosol-derived aglycone linked to multiple sugar moieties, typically including glucose and rhamnose. Known for its potent antioxidant, anti-inflammatory, and neuroprotective properties, Regaloside A has shown potential in preventing oxidative stress-induced cellular damage. Studies suggest it may modulate immune responses and protect against neurodegeneration, making it a promising candidate for therapeutic applications in aging and inflammatory disorders. Its natural origin and multifaceted bioactivity support its relevance in pharmacognosy and functional food research.
CAS Number | 114420-66-5 |
Synonyms | [(2S)-2-hydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
Molecular Formula | C18H24O10 |
Purity | ≥95% |
IUPAC Name | [(2S)-2-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C18H24O10/c19-7-13-15(23)16(24)17(25)18(28-13)27-9-12(21)8-26-14(22)6-3-10-1-4-11(20)5-2-10/h1-6,12-13,15-21,23-25H,7-9H2/b6-3+/t12-,13?,15?,16?,17?,18?/m1/s1 Create Date: 2006-02-27 |
InChIKey | PADHSFRQMFRWLS-MUWVXHEGSA-N |
SMILES | C1=CC(=CC=C1/C=C/C(=O)OC[C@H](COC2C(C(C(C(O2)CO)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |