For research use only. Not for therapeutic Use.
Regiolone is a natural compound isolated from certain fungi, including Curvularia lunata. This bioactive molecule belongs to the class of phytotoxic metabolites and exhibits herbicidal properties. Regiolone inhibits the growth of plants by interfering with essential physiological processes, making it a potential candidate for weed control in agriculture. Research on regiolone’s mode of action and environmental impact is ongoing, aiming to develop eco-friendly herbicides and understand its interactions with plant biology. The unique properties of regiolone highlight its potential applications in sustainable agriculture and crop management.
| Catalog Number | R064711 |
| CAS Number | 137494-04-3 |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (4R)-4,8-dihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| InChI | InChI=1S/C10H10O3/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h1-3,7,11-12H,4-5H2/t7-/m1/s1 |
| InChIKey | ZXYYTDCENDYKBR-SSDOTTSWSA-N |
| SMILES | C1CC(=O)C2=C(C1O)C=CC=C2O |
