For research use only. Not for therapeutic Use.
Regorafenib-d3 is a deuterated analog of Regorafenib, a multi-kinase inhibitor used primarily in oncology. This isotopic variant incorporates three deuterium atoms, enhancing its utility in pharmacokinetic and metabolic studies. Regorafenib-d3 targets various receptor kinases, including those involved in tumor angiogenesis and cell proliferation, thereby inhibiting cancer cell growth. It is used in research to trace drug metabolism and determine pharmacokinetic parameters with greater precision, which is crucial for optimizing therapeutic strategies and understanding drug behavior in clinical settings.
CAS Number | 1255386-16-3 |
Synonyms | 4-[4-[[[[4-Chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-N-(methyl-d3)-2-pyridinecarboxamide |
Molecular Formula | C21H15ClF4N4O3 |
Purity | ≥95% |
Target | Autophagy |
Storage | Store at +4C |
IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-N-(trideuteriomethyl)pyridine-2-carboxamide |
InChI | InChI=1S/C21H15ClF4N4O3/c1-27-19(31)18-10-13(6-7-28-18)33-12-3-5-17(16(23)9-12)30-20(32)29-11-2-4-15(22)14(8-11)21(24,25)26/h2-10H,1H3,(H,27,31)(H2,29,30,32)/i1D3 |
InChIKey | FNHKPVJBJVTLMP-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])NC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F |