For research use only. Not for therapeutic Use.
Regorafenib monohydrate(Cat No.:I000138)is a multi-kinase inhibitor that targets various signaling pathways involved in tumor growth and angiogenesis, including VEGFR, PDGFR, KIT, and RAF kinases. It disrupts both tumor proliferation and the formation of blood vessels that support tumor growth, making it effective in treating cancers such as metastatic colorectal cancer, gastrointestinal stromal tumors (GIST), and hepatocellular carcinoma. Regorafenib’s broad-spectrum activity against multiple kinases has made it a critical compound in oncology research, offering insights into targeted therapies for advanced, treatment-resistant cancers.
CAS Number | 1019206-88-2 |
Synonyms | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate |
Molecular Formula | C₂₁H₁₇ClF₄N₄O₄ |
Purity | ≥95% |
Target | Autophagy |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]-3-fluorophenoxy]-N-methylpyridine-2-carboxamide;hydrate |
InChI | InChI=1S/C21H15ClF4N4O3.H2O/c1-27-19(31)18-10-13(6-7-28-18)33-12-3-5-17(16(23)9-12)30-20(32)29-11-2-4-15(22)14(8-11)21(24,25)26;/h2-10H,1H3,(H,27,31)(H2,29,30,32);1H2 |
InChIKey | ZOPOQLDXFHBOIH-UHFFFAOYSA-N |
SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F.O |
Reference | <p style=/line-height:25px/> |