Home
>
Chemical Reagents>Heterocyclic Building Blocks> rel-(3R,4S)-tert-Butyl 3-acetamido-4-allyl-3-(tert-butylcarbamoyl)pyrrolidine-1-carboxylate
For research use only. Not for therapeutic Use.
rel-(3R,4S)-tert-Butyl 3-acetamido-4-allyl-3-(tert-butylcarbamoyl)pyrrolidine-1-carboxylate(Cat No.:L007181), is a complex chemical compound. It is a chiral pyrrolidine derivative containing multiple functional groups, including acetamido, allyl, and tert-butylcarbamoyl moieties. This compound is significant in medicinal chemistry and drug synthesis, often utilized as an intermediate for the creation of diverse biologically active molecules and potential pharmaceuticals. Its intricate structure and stereochemistry offer opportunities for designing novel compounds, contributing to drug discovery efforts, and developing specialized organic molecules for various therapeutic applications.
CAS Number | 1374334-12-9 |
Molecular Formula | C19H33N3O4 |
Purity | ≥95% |
IUPAC Name | tert-butyl (3R,4S)-3-acetamido-3-(tert-butylcarbamoyl)-4-prop-2-enylpyrrolidine-1-carboxylate |
InChI | InChI=1S/C19H33N3O4/c1-9-10-14-11-22(16(25)26-18(6,7)8)12-19(14,20-13(2)23)15(24)21-17(3,4)5/h9,14H,1,10-12H2,2-8H3,(H,20,23)(H,21,24)/t14-,19-/m0/s1 |
InChIKey | PSNFRMXIQNDKLS-LIRRHRJNSA-N |
SMILES | CC(=O)NC1(CN(CC1CC=C)C(=O)OC(C)(C)C)C(=O)NC(C)(C)C |