For research use only. Not for therapeutic Use.
rel-Biotin-d4 is the deuterium labeled Biotin. Biotin is an enzyme co-factor present in minute amounts in every living cell.
Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1].
| Catalog Number | R009250 |
| CAS Number | 1217850-77-5 |
| Synonyms | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid |
| Molecular Formula | C10H12D4N2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1/i1D2,2D2 |
| InChIKey | YBJHBAHKTGYVGT-CCSQOTJNSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 |
| Reference | [1]. Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. [2]. Zempleni, J. and D.M. Mock, Biotin biochemistry and human requirements. J Nutr Biochem, 1999. 10(3): p. 128-38. [3]. Mock, D.M., Biotin status: which are valid indicators and how do we know? J Nutr, 1999. 129(2S Suppl): p. 498S-503S. |
