For research use only. Not for therapeutic Use.
Reldesemtiv HCl(CAT: I035483) is a potent fast skeletal muscle troponin activator primarily relevant in neuromuscular research. It works by selectively increasing the calcium sensitivity of fast skeletal muscle troponin, enabling enhanced muscle contractility without increasing intracellular calcium levels. This unique mechanism reduces muscle fatigue and improves strength, making it particularly valuable in studying disorders like amyotrophic lateral sclerosis (ALS), spinal muscular atrophy (SMA), and other neuromuscular diseases. By amplifying the efficiency of muscle contraction, Reldesemtiv HCl helps researchers investigate therapeutic strategies to counteract muscle weakness and functional decline in patients with neuromuscular impairments.
| Catalog Number | I035483 |
| Synonyms | Reldesemtiv, CK-2127107; CK 2127107; CK2127107; CK-107; CK 107; CK107; Reldesemtiv HCl, 1345410-31-2 (free base), |
| Molecular Formula | C19H19ClF2N6O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-[2-({[trans-3-fluoro-1-(3-fluoropyridin-2-yl)cyclobutyl]methyl}amino)pyrimidin-5-yl]-1H-pyrrole-3-carboxamide hydrochloride |
| InChI | InChI=1S/C19H18F2N6O.ClH/c20-13-6-19(7-13,16-15(21)2-1-4-23-16)11-26-18-24-8-14(9-25-18)27-5-3-12(10-27)17(22)28;/h1-5,8-10,13H,6-7,11H2,(H2,22,28)(H,24,25,26);1H/t13-,19-; |
| InChIKey | VQNDYQWNJJMOLJ-YOHOECQTSA-N |
| SMILES | O=C(C1=CN(C2=CN=C(NC[C@]3(C4=NC=CC=C4F)C[C@H](F)C3)N=C2)C=C1)N.[H]Cl |
