For research use only. Not for therapeutic Use.
Remodelin(CAT: I005642) is a selective small-molecule inhibitor of N-acetyltransferase 10 (NAT10), an enzyme involved in RNA acetylation, DNA damage response, and nuclear architecture maintenance. By inhibiting NAT10, Remodelin improves nuclear envelope stability and corrects abnormal nuclear morphology, particularly in cells with defects in lamin A/C, such as those seen in Hutchinson-Gilford Progeria Syndrome (HGPS) and other laminopathies. Remodelin has shown promise in aging research and genetic disorder studies by reducing DNA damage and nuclear abnormalities. It is a valuable tool for exploring therapeutic strategies for premature aging syndromes and age-related diseases.
| Catalog Number | I005642 |
| CAS Number | 949912-58-7 |
| Synonyms | 4-[2-(2-cyclopentylidenehydrazinyl)-4-thiazolyl]-benzonitrile |
| Molecular Formula | C₁₅H₁₄N₄S |
| Purity | ≥95% |
| Target | Histone Acetyltransferase |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 4-[2-(2-cyclopentylidenehydrazinyl)-1,3-thiazol-4-yl]benzonitrile |
| InChI | InChI=1S/C15H14N4S/c16-9-11-5-7-12(8-6-11)14-10-20-15(17-14)19-18-13-3-1-2-4-13/h5-8,10H,1-4H2,(H,17,19) |
| InChIKey | XAEJIFARBQJLML-UHFFFAOYSA-N |
| SMILES | C1CCC(=NNC2=NC(=CS2)C3=CC=C(C=C3)C#N)C1 |
