For research use only. Not for therapeutic Use.
Repinotan Hydrochloride(Cat No.:R028431)is a selective serotonin 5-HT1A receptor agonist with significant potential in neurological research and therapeutic development. This compound, known for its neuroprotective and neurorestorative properties, is primarily investigated for treating ischemic stroke and other central nervous system disorders. Its high purity and reliable potency ensure consistent experimental outcomes, making it invaluable in preclinical and clinical studies. Repinotan Hydrochloride supports research into novel treatments for brain injuries and neurodegenerative diseases, contributing to advancements in understanding and managing complex neurological conditions.
CAS Number | 144980-77-8 |
Synonyms | 2-[4-[[(2R)-3,4-dihydro-2H-chromen-2-yl]methylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one;hydrochloride |
Molecular Formula | C21H25ClN2O4S |
Purity | ≥95% |
IUPAC Name | 2-[4-[[(2R)-3,4-dihydro-2H-chromen-2-yl]methylamino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one;hydrochloride |
InChI | InChI=1S/C21H24N2O4S.ClH/c24-21-18-8-2-4-10-20(18)28(25,26)23(21)14-6-5-13-22-15-17-12-11-16-7-1-3-9-19(16)27-17;/h1-4,7-10,17,22H,5-6,11-15H2;1H/t17-;/m1./s1 |
InChIKey | IGKYREHZJIHPML-UNTBIKODSA-N |
SMILES | C1CC2=CC=CC=C2OC1CNCCCCN3C(=O)C4=CC=CC=C4S3(=O)=O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |