For research use only. Not for therapeutic Use.
Repirinast-d4(Cat No.:R048879) is a deuterated form of Repirinast, where four hydrogen atoms are replaced with deuterium. This isotopic modification enhances the molecule’s stability, making it particularly useful for detailed pharmacokinetic and pharmacodynamic studies. Repirinast is an anti-inflammatory and anti-allergic compound, primarily used to manage asthma and allergic conditions. The deuterated version, Repirinast-d4, allows for precise tracking and analysis of the drug’s absorption, distribution, metabolism, and excretion in the body, facilitating a deeper understanding of its therapeutic effects and potential side effects, thus aiding in the development of safer and more effective treatments for respiratory and allergic disorders.
CAS Number | 1329836-95-4 |
Synonyms | 5,6-Dihydro-7,8-dimethyl-4,5-dioxo-4H-pyrano[3,2-c]quinoline-2-carboxylic Acid 3-Methylbutyl-d4 Ester; MY 5116-d4; Romet-d4; |
Molecular Formula | C20H21NO5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (1,1,2,2-tetradeuterio-3-methylbutyl) 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate |
InChI | InChI=1S/C20H21NO5/c1-10(2)7-8-25-20(24)15-9-14(22)16-18(26-15)13-6-5-11(3)12(4)17(13)21-19(16)23/h5-6,9-10H,7-8H2,1-4H3,(H,21,23)/i7D2,8D2 |
InChIKey | NFQIAEMCQGTTIR-OSEHSPPNSA-N |
SMILES | [2H]C([2H])(C(C)C)C([2H])([2H])OC(=O)C1=CC(=O)C2=C(O1)C3=C(C(=C(C=C3)C)C)NC2=O |