For research use only. Not for therapeutic Use.
RepSox (Cat No.:I003580)also known as E-616452, SJN 2511, ALK5 Inhibitor II, is a highly potent and selective inhibitor of TGFβ receptor-1 (ALK5). It specifically targets the ATP binding site of ALK5 and inhibits its autophosphorylation. In cell-free assays, RepSox demonstrates an IC50 of 23 nM for ATP binding to ALK5 and 4 nM for ALK5 autophosphorylation. By blocking ALK5 signaling, RepSox effectively modulates TGFβ pathway activity, which plays a critical role in various cellular processes.
| Catalog Number | I003580 |
| CAS Number | 446859-33-2 |
| Synonyms | 2-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]-1,5-naphthyridine |
| Molecular Formula | C17H13N5 |
| Purity | ≥95% |
| Target | SMAD |
| Solubility | DMSO: ≥ 52 mg/mL |
| Storage | 2-8°C |
| IC50 | 23 nM |
| IUPAC Name | 2-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]-1,5-naphthyridine |
| InChI | InChI=1S/C17H13N5/c1-11-4-2-5-16(20-11)17-12(10-19-22-17)13-7-8-14-15(21-13)6-3-9-18-14/h2-10H,1H3,(H,19,22) |
| InChIKey | LBPKYPYHDKKRFS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=C(C=NN2)C3=NC4=C(C=C3)N=CC=C4 |
