For research use only. Not for therapeutic Use.
Resolvin E1(Cat No.:R032992) is a potent bioactive lipid mediator derived from eicosapentaenoic acid (EPA). It plays a crucial role in resolving inflammation and promoting tissue repair. By binding to specific receptors, Resolvin E1 modulates immune responses, reducing the production of pro-inflammatory cytokines and promoting the clearance of inflammatory cells. This compound is essential in the development of new therapeutic strategies for inflammatory diseases, including arthritis and cardiovascular disorders. Its natural origin and effectiveness in controlling inflammation make it a valuable asset in medical research and drug development.
CAS Number | 552830-51-0 |
Synonyms | (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-Trihydroxy-6,8,10,14,16-eicosapentaenoic Acid |
Molecular Formula | C20H30O5 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -80°C |
IUPAC Name | (5S,6Z,8E,10E,12R,14Z,16E,18R)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoic acid |
InChI | InChI=1S/C20H30O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-9,11-13,17-19,21-23H,2,10,14-16H2,1H3,(H,24,25)/b4-3+,9-5-,11-8+,12-6+,13-7-/t17-,18+,19-/m1/s1 |
InChIKey | AOPOCGPBAIARAV-OTBJXLELSA-N |
SMILES | CCC(C=CC=CCC(C=CC=CC=CC(CCCC(=O)O)O)O)O |