For research use only. Not for therapeutic Use.
Resorantel（Cat No.:I035508） is an anthelmintic agent used to treat parasitic worm infections in animals. It is commonly used in veterinary medicine to combat various gastrointestinal nematodes, such as Haemonchus, Ostertagia, and Trichostrongylus species, which can infest livestock and cause significant health issues. Resorantel works by disrupting the nervous system of the parasites, leading to paralysis and subsequent expulsion from the host’s body. Its anthelmintic properties make it an important tool in the management of worm infestations in animals.
| Catalog Number | I035508 |
| CAS Number | 20788-07-2 |
| Synonyms | HOE296 V; HOE 296 V; HOE-296 V; Resorantel |
| Molecular Formula | C13H10BrNO3 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | 2-8°C |
| IUPAC Name | N-(4-bromophenyl)-2,6-dihydroxybenzamide |
| InChI | InChI=1S/C13H10BrNO3/c14-8-4-6-9(7-5-8)15-13(18)12-10(16)2-1-3-11(12)17/h1-7,16-17H,(H,15,18) |
| InChIKey | IHYNKGRWCDKNEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C(=O)NC2=CC=C(C=C2)Br)O |
| Reference | 1. Gruss B, Malan FS, Roper NA, du Plessis C, Ashburner AJ. The anthelmintic efficacy of resorantel against Houttuynia struthionis in ostriches. J S Afr Vet Assoc. 1988 Dec;59(4):207-8. PMID: 3210222. |
