For research use only. Not for therapeutic Use.
Resorcinol monoacetate (Acetylresorcinol) is an antiseptic and a disinfectant, is a chemical intermediate for the production of many other pharmaceuticals, and has the potential for acne, seborrheic dermatitis, eczema, psoriasis, and other skin disorders research.
| Catalog Number | I000158 |
| CAS Number | 102-29-4 |
| Synonyms | (3-hydroxyphenyl) acetate |
| Molecular Formula | C8H8O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C8H8O3/c1-6(9)11-8-4-2-3-7(10)5-8/h2-5,10H,1H3 |
| InChIKey | ZZPKZRHERLGEKA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)O |
