For research use only. Not for therapeutic Use.
Resorufin butyrate（Cat No.:M082028）is a fluorogenic compound used primarily in scientific research as a substrate for assessing enzymatic activity, particularly for esterases and lipases. The compound consists of a resorufin moiety linked to a butyrate group, and when hydrolyzed by esterases, it releases resorufin, a fluorescent product. This fluorescence can be measured to monitor enzyme activity in various biological assays. Resorufin butyrate is commonly utilized in drug discovery, enzyme kinetics studies, and screening applications, helping to identify compounds that modulate esterases or lipases for therapeutic purposes.
| CAS Number | 15585-42-9 |
| Synonyms | (7-oxophenoxazin-3-yl) butanoate |
| Molecular Formula | C16H13NO4 |
| Purity | ≥95% |
| IUPAC Name | (7-oxophenoxazin-3-yl) butanoate |
| InChI | InChI=1S/C16H13NO4/c1-2-3-16(19)20-11-5-7-13-15(9-11)21-14-8-10(18)4-6-12(14)17-13/h4-9H,2-3H2,1H3 |
| InChIKey | RGJTZDRUTUWWTD-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |
