For research use only. Not for therapeutic Use.
Retinyl Retinoate is a high-purity derivative of retinoic acid essential for advanced pharmaceutical and dermatological research. This compound is crucial for studies involving skin aging, cellular differentiation, and gene expression. Known for its stability and enhanced bioavailability, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R019549 |
CAS Number | 15498-86-9 |
Synonyms | Retinoic Acid Retin-15-yl Ester; Retinoic Acid Ester with Retinol |
Molecular Formula | C40H56O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
InChI | InChI=1S/C40H56O2/c1-30(21-23-36-34(5)19-13-26-39(36,7)8)15-11-17-32(3)25-28-42-38(41)29-33(4)18-12-16-31(2)22-24-37-35(6)20-14-27-40(37,9)10/h11-12,15-18,21-25,29H,13-14,19-20,26-28H2,1-10H3/b17-11+,18-12+,23-21+,24-22+,30-15+,31-16+,32-25+,33-29+ |
InChIKey | QNCTWCFXYGJGKU-CHOOPKNISA-N |
SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCOC(=O)C=C(C)C=CC=C(C)C=CC2=C(CCCC2(C)C)C)C)C |