For research use only. Not for therapeutic Use.
Retro-2(Cat No.:R067066)is a small-molecule inhibitor that disrupts retrograde transport between endosomes and the Golgi apparatus. By targeting the endoplasmic reticulum exit site protein Sec16A, Retro-2 impedes the trafficking of toxins and pathogens that exploit this pathway, such as ricin and Shiga-like toxins. This inhibition prevents these agents from reaching their intracellular targets, thereby protecting cells from their harmful effects. Additionally, Retro-2 has demonstrated efficacy against certain viruses and intracellular bacteria, making it a valuable tool in studying cellular transport mechanisms and developing therapeutic strategies against various pathogens.
CAS Number | 1429192-00-6 |
Synonyms | 2,3-dihydro-2-(5-methyl-2-thienyl)-3-phenyl-4(1H)-quinazolinone |
Molecular Formula | C19H16N2OS |
Purity | ≥95% |
Target | Virus Protease |
Storage | -20°C |
IUPAC Name | 2-(5-methylthiophen-2-yl)-3-phenyl-1,2-dihydroquinazolin-4-one |
InChI | InChI=1S/C19H16N2OS/c1-13-11-12-17(23-13)18-20-16-10-6-5-9-15(16)19(22)21(18)14-7-3-2-4-8-14/h2-12,18,20H,1H3 |
InChIKey | BOAPXDSRULBILC-UHFFFAOYSA-N |
SMILES | CC1=CC=C(S1)C2NC3=CC=CC=C3C(=O)N2C4=CC=CC=C4 |