For research use only. Not for therapeutic Use.
Retrotestosterone is a biochemical that affects testosterone.
| Catalog Number | I035516 |
| CAS Number | 571-41-5 |
| Synonyms | Retrotestosterone; Lumitestosterone; |
| Molecular Formula | C19H28O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (8R,9R,10S,13S,14S,17S)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | MUMGGOZAMZWBJJ-UESMBRTFSA-N |
| SMILES | C[C@@]12[C@@H](O)CC[C@@]1([H])[C@]3([H])CCC4=CC(CC[C@@]4(C)[C@]3([H])CC2)=O |
| Reference | 1: Sarkar SL, Jogi KV, Tripathy AS. Effect of retrotestosterone on accessory sex |
