For research use only. Not for therapeutic Use.
Rezivertinib analogue 1（Cat No.:I042907）is a synthetic derivative of Rezivertinib, a small molecule inhibitor targeting the epidermal growth factor receptor (EGFR) mutation commonly found in non-small cell lung cancer (NSCLC). This analogue is designed to enhance the potency and selectivity of the original compound against specific EGFR mutations, including those resistant to first-line therapies. By inhibiting aberrant EGFR signaling, Rezivertinib analogue 1 aims to reduce tumor cell proliferation and overcome drug resistance, offering potential as a therapeutic agent in the treatment of advanced or metastatic NSCLC and other EGFR-driven cancers.
| CAS Number | 2227103-37-7 |
| Synonyms | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]acetamide |
| Molecular Formula | C27H33N7O2 |
| Purity | ≥95% |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylamino]-4-methoxy-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]phenyl]acetamide |
| InChI | InChI=1S/C27H33N7O2/c1-18(35)29-22-15-23(26(36-6)16-25(22)33(4)14-13-32(2)3)31-27-28-12-11-21(30-27)20-17-34(5)24-10-8-7-9-19(20)24/h7-12,15-17H,13-14H2,1-6H3,(H,29,35)(H,28,30,31) |
| InChIKey | FZPRMSLRRIEUNO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1N(C)CCN(C)C)OC)NC2=NC=CC(=N2)C3=CN(C4=CC=CC=C43)C |
