For research use only. Not for therapeutic Use.
Rezvilutamide is a biomolecule.
| Catalog Number | I035530 |
| CAS Number | 1572045-62-5 |
| Synonyms | Rezvilutamide |
| Molecular Formula | C22H20F3N3O4S |
| Purity | 98% |
| Target | Androgen Receptor |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-(3-{4-[(2S)-2,3-dihydroxypropoxy]phenyl}-4,4-dimethyl-5-oxo-2-sulfanylideneimidazolidin-1-yl)-2 (trifluoromethyl)benzonitrile antiandrogen |
| InChI | InChI=1S/C22H20F3N3O4S/c1-21(2)19(31)27(15-4-3-13(10-26)18(9-15)22(23,24)25)20(33)28(21)14-5-7-17(8-6-14)32-12-16(30)11-29/h3-9,16,29-30H,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | KRBMOYIWQCZVHA-INIZCTEOSA-N |
| SMILES | N#CC1=CC=C(N(C(N(C2=CC=C(OC[C@@H](O)CO)C=C2)C3(C)C)=S)C3=O)C=C1C(F)(F)F |
