For research use only. Not for therapeutic Use.
RGW 611 is a morpholine derivative that enhances radiation-induced cell death of hypoxic V79-379A cells[1].
| Catalog Number | R030417 |
| CAS Number | 6497-78-5 |
| Synonyms | 4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine |
| Molecular Formula | C9H14N4O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C9H14N4O3/c14-13(15)9-7-12(8-10-9)2-1-11-3-5-16-6-4-11/h7-8H,1-6H2 |
| InChIKey | VDZAAIIQCHGJAD-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCN2C=C(N=C2)[N+](=O)[O-] |
| Reference | [1]. Adams GE, et al. Structure-activity relationships in the development of hypoxic cell radiosensitizers. III. Effects of basic substituents in nitroimidazole sidechains. Int J Radiat Biol Relat Stud Phys Chem Med. 1980 Dec;38(6):613-26. |
