For research use only. Not for therapeutic Use.
RH01687(Cat No.:I009030)is a selective small molecule inhibitor designed to target specific enzymes involved in cellular processes such as inflammation and cancer progression. In preclinical studies, RH01687 has demonstrated the ability to modulate key signaling pathways, potentially inhibiting tumor growth and improving the efficacy of other cancer therapies. It shows promise in managing various cancers by disrupting the activity of proteins crucial for cell survival and proliferation. Additionally, RH01687 has been explored for its anti-inflammatory properties, making it a potential candidate for treating autoimmune diseases and chronic inflammatory conditions.
CAS Number | 302901-13-9 |
Synonyms | RH01687; RH-01687; RH 01687.;3-(4-Chloro-2-nitro-5-pyrrol-1-ylphenyl)sulfanyl-1H-1,2,4-triazol-5-amine |
Molecular Formula | C12H9ClN6O2S |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4 °C for short term, or -20 °C for long term |
IUPAC Name | 3-(4-chloro-2-nitro-5-pyrrol-1-ylphenyl)sulfanyl-1H-1,2,4-triazol-5-amine |
InChI | InChI=1S/C12H9ClN6O2S/c13-7-5-9(19(20)21)10(22-12-15-11(14)16-17-12)6-8(7)18-3-1-2-4-18/h1-6H,(H3,14,15,16,17) |
InChIKey | BOVTVNWNYFQVMI-UHFFFAOYSA-N |
SMILES | C1=CN(C=C1)C2=CC(=C(C=C2Cl)[N+](=O)[O-])SC3=NNC(=N3)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |