For research use only. Not for therapeutic Use.
RH1 is a bioreductive prodrug designed to target and kill cancer cells, particularly under hypoxic conditions typical of solid tumors. It is activated by the enzyme NAD(P)H
oxidoreductase 1 (NQO1), which is overexpressed in many cancer cells. Once activated, RH1 generates cytotoxic species that induce DNA damage and apoptosis in tumor cells. Its selective activation in cancer cells, combined with its potential to overcome hypoxia-associated resistance to therapy, makes RH1 a promising candidate in cancer treatment research.
| Catalog Number | I009031 |
| CAS Number | 221635-42-3 |
| Synonyms | 2,5-bis(aziridin-1-yl)-3-(hydroxymethyl)-6-methylcyclohexa-2,5-diene-1,4-dione |
| Molecular Formula | C12H14N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H14N2O3/c1-7-9(13-2-3-13)12(17)8(6-15)10(11(7)16)14-4-5-14/h15H,2-6H2,1H3 |
| InChIKey | JKDLOGLNPDVUCX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C(=C(C1=O)N2CC2)CO)N3CC3 |
