For research use only. Not for therapeutic Use.
Rhamnocitrin is a naturally occurring flavonoid found in certain plants, including fruits and vegetables. It belongs to the flavone subclass of flavonoids and is characterized by its chemical structure with hydroxyl groups attached to specific positions on the flavone scaffold. Rhamnocitrin exhibits antioxidant properties and may have potential health benefits, including anti-inflammatory and anticancer effects. Its presence in dietary sources underscores its role in promoting health and wellness through natural phytochemicals.
| Catalog Number | R056432 |
| CAS Number | 569-92-6 |
| Molecular Formula | C16H12O6 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Storage | Store at -20°C |
| IUPAC Name | 3,5-dihydroxy-2-(4-hydroxyphenyl)-7-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O6/c1-21-10-6-11(18)13-12(7-10)22-16(15(20)14(13)19)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| InChIKey | MQSZRBPYXNEFHF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC=C(C=C3)O)O |
