For research use only. Not for therapeutic Use.
Rhein(Cat No.:I003676) is a lipophilic anthraquinone compound that is commonly found in medicinal herbs. It exhibits a wide range of pharmacological effects, making it a valuable compound in traditional medicine. Rhein has been studied for its hepatoprotective and nephroprotective properties, showing potential benefits for liver and kidney health. Additionally, it possesses anti-inflammatory, antioxidant, anticancer, and antimicrobial activities. These diverse pharmacological effects make rhein a promising candidate for the development of therapeutic interventions in various diseases, including liver and kidney disorders, inflammation-related conditions, cancer, and microbial infections.
CAS Number | 478-43-3 |
Synonyms | NSC 38629;Rheic Acid |
Molecular Formula | C15H8O6 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 10 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
InChI | InChI=1S/C15H8O6/c16-9-3-1-2-7-11(9)14(19)12-8(13(7)18)4-6(15(20)21)5-10(12)17/h1-5,16-17H,(H,20,21) |
InChIKey | FCDLCPWAQCPTKC-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |