For research use only. Not for therapeutic Use.
Rho-Kinase-IN-2(Cat No.:I043326)is a selective inhibitor of Rho-associated protein kinase (ROCK), specifically targeting the ROCK2 isoform. ROCK enzymes are involved in regulating actin cytoskeleton dynamics, cell motility, and smooth muscle contraction. Dysregulation of ROCK activity is associated with various diseases, including cancer, cardiovascular disorders, and fibrosis. By inhibiting ROCK2, Rho-Kinase-IN-2 aims to reduce pathological cell movement, inflammation, and fibrosis, offering potential therapeutic applications in treating conditions such as pulmonary fibrosis, hypertension, and cancer metastasis. This compound is being studied for its ability to selectively modulate ROCK2 activity and improve disease outcomes.
CAS Number | 2573071-18-6 |
Synonyms | (2R)-4-(3-fluoropyridin-4-yl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-2-methylpiperazine-1-carboxamide |
Molecular Formula | C20H25FN4O2 |
Purity | ≥95% |
IUPAC Name | (2R)-4-(3-fluoropyridin-4-yl)-N-[(1R)-1-(3-methoxyphenyl)ethyl]-2-methylpiperazine-1-carboxamide |
InChI | InChI=1S/C20H25FN4O2/c1-14-13-24(19-7-8-22-12-18(19)21)9-10-25(14)20(26)23-15(2)16-5-4-6-17(11-16)27-3/h4-8,11-12,14-15H,9-10,13H2,1-3H3,(H,23,26)/t14-,15-/m1/s1 |
InChIKey | CIPXFTLGPVQJKN-HUUCEWRRSA-N |
SMILES | C[C@@H]1CN(CCN1C(=O)N[C@H](C)C2=CC(=CC=C2)OC)C3=C(C=NC=C3)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |