For research use only. Not for therapeutic Use.
Rhodamine B isothiocyanate (RBITC) is a fluorescent dye commonly used in biological imaging and labeling applications. It has an isothiocyanate functional group that can be covalently attached to amino groups on proteins and other biomolecules, making it useful for fluorescent labeling of cells and tissues. RBITC fluoresces bright orange-red under green light excitation, which makes it easy to detect and track labeled molecules in complex samples. Due to its stability and sensitivity, RBITC has been widely used in various research fields, including cell biology, immunology, and neurobiology.
Rhodamine B isothiocyanate is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
CAS Number | 36877-69-7 |
Synonyms | [9-(2-carboxy-6-isothiocyanatophenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium;chloride |
Molecular Formula | C29H30ClN3O3S |
Purity | ≥95% |
InChI | InChI=1S/C29H29N3O3S.ClH/c1-5-31(6-2)19-12-14-21-25(16-19)35-26-17-20(32(7-3)8-4)13-15-22(26)27(21)28-23(29(33)34)10-9-11-24(28)30-18-36;/h9-17H,5-8H2,1-4H3;1H |
InChIKey | ASPXTKVHMNAXGJ-UHFFFAOYSA-N |
SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=CC=C4N=C=S)C(=O)O.[Cl-] |