For research use only. Not for therapeutic Use.
Rhodblock 6(Cat No.:I012265)is a selective small molecule inhibitor of the protein kinase C (PKC) isoform, PKCβ. PKCβ is involved in various signaling pathways related to inflammation, cell proliferation, and survival, and has been implicated in conditions such as cancer, autoimmune diseases, and diabetic complications. By targeting PKCβ, Rhodblock 6 has shown potential in preclinical studies for treating conditions where dysregulated PKC signaling contributes to disease progression, particularly in cancer and inflammatory diseases.
CAS Number | 886625-06-5 |
Synonyms | N-1H-Indazol-5-yl-cyclobutanecarboxamide |
Molecular Formula | C12H13N3O |
Purity | ≥95% |
Target | TGF-beta/Smad |
IUPAC Name | N-(1H-indazol-5-yl)cyclobutanecarboxamide |
InChI | InChI=1S/C12H13N3O/c16-12(8-2-1-3-8)14-10-4-5-11-9(6-10)7-13-15-11/h4-8H,1-3H2,(H,13,15)(H,14,16) |
InChIKey | GXJXOQKXBIPBKB-UHFFFAOYSA-N |
SMILES | C1CC(C1)C(=O)NC2=CC3=C(C=C2)NN=C3 |