For research use only. Not for therapeutic Use.
Ribavirin-13C5(Cat No.:S000348) is a labeled variant of ribavirin, where five carbon atoms are enriched with the stable isotope carbon-13 (13C). Ribavirin is an antiviral medication used primarily to treat hepatitis C and certain viral hemorrhagic fevers. This 13C labeling allows for precise tracking and analysis of ribavirin’s metabolic pathways and its interactions within biological systems, using techniques like mass spectrometry. Understanding these metabolic pathways helps optimize dosing and efficacy, reduce potential side effects, and improve overall treatment outcomes by providing insights into the drug’s absorption, distribution, metabolism, and excretion processes.
CAS Number | 1646818-35-0 |
Molecular Formula | C313C5H12N4O5 |
Purity | ≥95% |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxy(113C)methyl)(2,3,4,5-13C4)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
InChI | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1/i1+1,3+1,4+1,5+1,8+1 |
InChIKey | IWUCXVSUMQZMFG-XYJHPSJVSA-N |
SMILES | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N |