For research use only. Not for therapeutic Use.
Ribavirin 5’-Monophosphate dilithium salt is a phosphorylated derivative of ribavirin, an antiviral nucleoside analog used in the treatment of various viral infections, such as hepatitis C and respiratory syncytial virus (RSV). The monophosphate form represents the first step in ribavirin’s bioactivation pathway, as it is further phosphorylated into its active triphosphate form, which inhibits viral RNA polymerase and other key enzymes involved in viral replication. The dilithium salt version of ribavirin 5′-monophosphate enhances its solubility and stability, making it more suitable for research and pharmaceutical formulations. It is commonly used in studies focusing on antiviral mechanisms and drug development.
CAS Number | 66983-94-6 |
Synonyms | 1-(5-O-Phosphono-β-D-ribofuranosyl)-1H-1,2,4-triazole-3-carboxamide Dilithium Salt; |
Molecular Formula | C8H11Li2N4O8P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dilithium;[5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
InChI | InChI=1S/C8H13N4O8P.2Li/c9-6(15)7-10-2-12(11-7)8-5(14)4(13)3(20-8)1-19-21(16,17)18;;/h2-5,8,13-14H,1H2,(H2,9,15)(H2,16,17,18);;/q;2*+1/p-2 |
InChIKey | SIMMZIYZANJRNU-UHFFFAOYSA-L |
SMILES | [Li+].[Li+].C1=NC(=NN1C2C(C(C(O2)COP(=O)([O-])[O-])O)O)C(=O)N |