For research use only. Not for therapeutic Use.
Ribavirin（Cat No.:A000398）is a broad-spectrum antiviral agent widely used to treat various RNA and DNA virus infections. It works by inhibiting viral RNA-dependent RNA polymerase, disrupting viral replication. Ribavirin is commonly used in combination with other therapies, such as interferons for hepatitis C virus (HCV) and antivirals for respiratory syncytial virus (RSV) infections. Its mechanism also involves inducing lethal mutagenesis in viral genomes. Despite its efficacy, ribavirin can cause side effects such as hemolytic anemia, necessitating careful monitoring during treatment. It remains a critical tool in antiviral therapeutics and research.
| CAS Number | 36791-04-5 |
| Synonyms | 36791-04-5; Tribavirin; Virazole; Ribavirine; Copegus |
| Molecular Formula | C8H12N4O5 |
| Purity | ≥95% |
| Target | HCV |
| Storage | -20°C |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| InChI | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 |
| InChIKey | IWUCXVSUMQZMFG-AFCXAGJDSA-N |
| SMILES | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N |
