For research use only. Not for therapeutic Use.
Ridane hydrobromide ( Cat No.:R056949 ) is a chemical compound, typically encountered as a hydrobromide salt to improve solubility and stability. Although specific details about its use and applications are not widely known in the public domain, compounds like ridane hydrobromide are often explored in pharmaceutical and chemical research for their potential biological or chemical activity. Such compounds can be involved in studies aiming to develop new medications, particularly in areas requiring highly soluble and stable chemical forms for therapeutic purposes.
CAS Number | 64543-93-7 |
Synonyms | trans-1-(3-Methoxy-2-piperidinyl)-2-propanone Hydrobromide; |
Molecular Formula | C₉H₁₈BrNO₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-[(2R,3S)-3-methoxypiperidin-2-yl]propan-2-one;hydrobromide |
InChI | 1S/C9H17NO2.BrH/c1-7(11)6-8-9(12-2)4-3-5-10-8;/h8-10H,3-6H2,1-2H3;1H/t8-,9+;/m1./s1 |
InChIKey | DVSQBUUDEVNABC-RJUBDTSPSA-N |
SMILES | CC(=O)C[C@@H]1[C@H](CCCN1)OC.Br |