For research use only. Not for therapeutic Use.
Rigin is a Tuftsin-like tetrapeptide with equal phagocytosis stimulating activity.
| Catalog Number | I035577 |
| CAS Number | 77727-17-4 |
| Synonyms | Gly-gln-pro-arg; GQPR; Rigin; Tetrapeptide-3; Tetrapeptide-7 |
| Molecular Formula | C18H32N8O6 |
| Purity | 98% |
| Target | Disease Research Fields |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | L-Arginine, N2-(1-(N2-glycyl-L-glutaminyl)-L-prolyl)- |
| InChI | InChI=1S/C18H32N8O6/c19-9-14(28)24-10(5-6-13(20)27)16(30)26-8-2-4-12(26)15(29)25-11(17(31)32)3-1-7-23-18(21)22/h10-12H,1-9,19H2,(H2,20,27)(H,24,28)(H,25,29)(H,31,32)(H4,21,22,23)/t10-,11-,12-/m0/s1 |
| InChIKey | UEJYSALTSUZXFV-SRVKXCTJSA-N |
| SMILES | NCC(=O)N[C@@H](CCC(=O)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Reference | 1. Dutta RC, Puri A, Anand N. Immunomodulatory potential of hydrophobic analogs of Rigin and their role in providing protection against Plasmodium berghei infection in mice. Int Immunopharmacol. 2001 May;1(5):843-55. doi: 10.1016/s1567-5769(01)00021-2. PMID: 11379040. |
