For research use only. Not for therapeutic Use.
Rigosertib sodium(Cat No.:I004220)is a multi-kinase inhibitor that primarily targets the Ras/Raf signaling pathway, disrupting multiple signaling cascades essential for cancer cell survival and proliferation. It inhibits polo-like kinase 1 (PLK1) and phosphoinositide 3-kinase (PI3K), leading to cell cycle arrest and apoptosis in cancer cells. Rigosertib sodium is being investigated for its potential in treating myelodysplastic syndromes (MDS) and other hematological malignancies. Its ability to selectively target cancer cells while sparing normal cells makes it a promising agent in cancer therapy, particularly for resistant or refractory cancers.
CAS Number | 592542-60-4 |
Synonyms | sodium;2-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]anilino]acetate |
Molecular Formula | C21H24NNaO8S |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Solubility | H2O: ≥ 52 mg/mL |
Storage | Store at -20C |
IC50 | 9 nM |
IUPAC Name | sodium;2-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]anilino]acetate |
InChI | InChI=1S/C21H25NO8S.Na/c1-27-15-10-19(29-3)16(20(11-15)30-4)7-8-31(25,26)13-14-5-6-18(28-2)17(9-14)22-12-21(23)24;/h5-11,22H,12-13H2,1-4H3,(H,23,24);/q;+1/p-1/b8-7+; |
InChIKey | VLQLUZFVFXYXQE-USRGLUTNSA-M |
SMILES | COC1=C(C=C(C=C1)CS(=O)(=O)C=CC2=C(C=C(C=C2OC)OC)OC)NCC(=O)[O-].[Na+] |
Reference | <p style=”/line-height:25px/”> |