For research use only. Not for therapeutic Use.
Riligustilide(CAT: R064472) is a naturally occurring compound found in certain plant species, particularly in Chinese herbal medicine. It is a phthalide derivative known for its potential therapeutic properties, including cardiovascular benefits and vasodilation effects. Riligustilide has been of interest in pharmacological research for its potential in the treatment of cardiovascular diseases and its impact on blood vessel function.
CAS Number | 89354-45-0 |
Molecular Formula | C24H28O4 |
Purity | ≥95% |
Documentation | |
Target | Plants |
Storage | -20°C |
IUPAC Name | (3S,3/'Z,5/'aR,6/'S,7/'aS)-3/'-butylidene-6/'-propylspiro[4,5-dihydro-2-benzofuran-3,7/'-5,5a,6,7a-tetrahydro-4H-cyclobuta[g][2]benzofuran]-1,1/'-dione |
InChI | InChI=1S/C24H28O4/c1-3-5-11-19-16-13-12-14-17(8-4-2)24(21(14)20(16)23(26)27-19)18-10-7-6-9-15(18)22(25)28-24/h6,9,11,14,17,21H,3-5,7-8,10,12-13H2,1-2H3/b19-11-/t14-,17+,21+,24-/m1/s1 |
InChIKey | TYSOMZQRYGBSKN-DRQJQJQISA-N |
SMILES | CCCC=C1C2=C(C3C(CC2)C(C34C5=C(C=CCC5)C(=O)O4)CCC)C(=O)O1 |