For research use only. Not for therapeutic Use.
Rimantadine Hydrochloride(Cat No.:I001856)is an antiviral medication primarily used to prevent and treat influenza A infections. By inhibiting the viral M2 protein, rimantadine blocks viral uncoating and replication within host cells, effectively reducing viral spread and symptoms. It is often administered during flu outbreaks or as a preventive measure in high-risk populations. Rimantadine hydrochloride is known for its favorable pharmacokinetics, offering fewer central nervous system side effects compared to similar antivirals. Although effective, its use has diminished with the rise of resistant influenza strains, making it most valuable in targeted applications.
CAS Number | 1501-84-4 |
Synonyms | (R)-1-((1s,3R,5S,7S)-adamantan-1-yl)ethanamine hydrochloride |
Molecular Formula | C12H22ClN |
Purity | ≥95% |
Target | Influenza Virus |
Solubility | DMSO: ≥ 2.5 mg/mL |
Storage | Store at -20C |
IUPAC Name | 1-(1-adamantyl)ethanamine;hydrochloride |
InChI | InChI=1S/C12H21N.ClH/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12;/h8-11H,2-7,13H2,1H3;1H |
InChIKey | OZBDFBJXRJWNAV-UHFFFAOYSA-N |
SMILES | CC(C12CC3CC(C1)CC(C3)C2)N.Cl |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |