Rimonabant Hydrochloride（Cat No.:I002014）is a selective cannabinoid receptor type 1 (CB1) antagonist that was developed for the treatment of obesity and metabolic disorders. By blocking CB1 receptors in the brain, it reduces appetite and promotes weight loss. Additionally, Rimonabant has been investigated for its effects on improving lipid profiles and insulin sensitivity, offering potential benefits for managing type 2 diabetes and cardiovascular risk factors. However, due to concerns over psychiatric side effects, such as depression and anxiety, its use was discontinued, but it remains a subject of interest in cannabinoid receptor research.
| Catalog Number | I002014 |
| CAS Number | 158681-13-1 |
| Synonyms | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride |
| Molecular Formula | C22H22Cl4N4O |
| Purity | ≥95% |
| Target | Cannabinoid Receptor |
| Solubility | in DMSO> 10 mM |
| Storage | Store at -20°C |
| IC50 | 1.8 nM(Ki) |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide;hydrochloride |
| InChI | InChI=1S/C22H21Cl3N4O.ClH/c1-14-20(22(30)27-28-11-3-2-4-12-28)26-29(19-10-9-17(24)13-18(19)25)21(14)15-5-7-16(23)8-6-15;/h5-10,13H,2-4,11-12H2,1H3,(H,27,30);1H |
| InChIKey | REOYOKXLUFHOBV-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(=O)NN2CCCCC2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)Cl.Cl |
| Reference | <p style=/line-height:25px/> |
