For research use only, not for therapeutic use.
Rimonabant（Cat No.:I002198）is a selective cannabinoid receptor type 1 (CB1) antagonist that was developed to treat obesity and related metabolic disorders. By blocking CB1 receptors in the brain, Rimonabant reduces appetite and promotes weight loss. It also showed potential for improving lipid profiles and insulin sensitivity, making it useful for managing cardiovascular risks associated with obesity and type 2 diabetes. However, due to concerns over psychiatric side effects, including depression and anxiety, Rimonabant was withdrawn from the market, although it remains a significant compound in cannabinoid receptor research.
| Catalog Number | I002198 |
| CAS Number | 168273-06-1 |
| Synonyms | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| Molecular Formula | C22H21Cl3N4O |
| Purity | ≥95% |
| Target | Cannabinoid Receptor |
| Solubility | DMSO 25 mg/mL; Water <1 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 1.8 nM(Ki) |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methyl-N-piperidin-1-ylpyrazole-3-carboxamide |
| InChI | InChI=1S/C22H21Cl3N4O/c1-14-20(22(30)27-28-11-3-2-4-12-28)26-29(19-10-9-17(24)13-18(19)25)21(14)15-5-7-16(23)8-6-15/h5-10,13H,2-4,11-12H2,1H3,(H,27,30) |
| InChIKey | JZCPYUJPEARBJL-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1C(=O)NN2CCCCC2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)Cl |
| Reference | <p style=/line-height:25px/> |
