For research use only. Not for therapeutic Use.
Risedronate is a bisphosphonate used to strengthen bone, treat or prevent osteoporosis, and treat Paget/’s disease of bone.
| Catalog Number | A001150 |
| CAS Number | 105462-24-6 |
| Synonyms | Risedronic Acid |
| Molecular Formula | C7H11NO7P2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | (1-hydroxy-1-phosphono-2-pyridin-3-ylethyl)phosphonic acid |
| InChI | InChI=1S/C7H11NO7P2/c9-7(16(10,11)12,17(13,14)15)4-6-2-1-3-8-5-6/h1-3,5,9H,4H2,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | IIDJRNMFWXDHID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CC(O)(P(=O)(O)O)P(=O)(O)O |
