For research use only. Not for therapeutic Use.
Rivenprost(CAT: R064521) is a synthetic prostaglandin analog designed to mimic the biological actions of endogenous prostaglandins. It is primarily studied for its potential in promoting vasodilation, reducing inflammation, and regulating smooth muscle function. Due to these properties, Rivenprost has been investigated for its therapeutic applications in cardiovascular diseases, such as hypertension and atherosclerosis, as well as in conditions that involve impaired blood flow. Additionally, it may play a role in managing reproductive health by influencing uterine contractions. Its ability to modulate inflammatory pathways and vascular tone makes it a promising compound for ongoing pharmaceutical and biomedical research.
| Catalog Number | R064521 |
| CAS Number | 256382-08-8 |
| Synonyms | ONO-4819 |
| Molecular Formula | C24H34O6S |
| Purity | ≥95% |
| Target | Prostaglandin Receptor |
| Storage | -20°C |
| IUPAC Name | methyl 4-[2-[(1R,2R,3R)-3-hydroxy-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-5-oxocyclopentyl]ethylsulfanyl]butanoate |
| InChI | InChI=1S/C24H34O6S/c1-29-16-18-6-3-5-17(13-18)14-19(25)8-9-20-21(23(27)15-22(20)26)10-12-31-11-4-7-24(28)30-2/h3,5-6,8-9,13,19-22,25-26H,4,7,10-12,14-16H2,1-2H3/b9-8+/t19-,20-,21-,22-/m1/s1 |
| InChIKey | FBQUXLIJKPWCAO-AZIFJQEOSA-N |
| SMILES | COCC1=CC=CC(=C1)CC(C=CC2C(CC(=O)C2CCSCCCC(=O)OC)O)O |
