For research use only. Not for therapeutic Use.
RN-18 is an HIV-1 Vif inhibitor. RN-18 antagonizes Vif function and inhibits HIV-1 replication only in the presence of A3G. RN-18 increases cellular A3G levels in a Vif-dependent manner and increases A3G incorporation into virions without inhibiting general proteasome-mediated protein degradation. RN-18 enhances Vif degradation only in the presence of A3G, reduces viral infectivity by increasing A3G incorporation into virions and enhances cytidine deamination of the viral genome.
| Catalog Number | I012005 |
| CAS Number | 431980-38-0 |
| Synonyms | RN-18; RN 18; RN18.;N-(2-methoxyphenyl)-2-[(4-nitrophenyl)thio]-benzamide |
| Molecular Formula | C20H16N2O4S |
| Purity | ≥95% |
| Target | HIV-1 Vif inhibitor |
| Solubility | Soluble in DMSO |
| Storage | Store at 0-8 °C |
| InChI | InChI=1S/C20H16N2O4S/c1-26-18-8-4-3-7-17(18)21-20(23)16-6-2-5-9-19(16)27-15-12-10-14(11-13-15)22(24)25/h2-13H,1H3,(H,21,23) |
| InChIKey | JKNUDHUHXMELIJ-UHFFFAOYSA-N |
| SMILES | O=C(NC1=CC=CC=C1OC)C2=CC=CC=C2SC3=CC=C([N+]([O-])=O)C=C3 |
